C18H33NOS — CID 155329114
(4E,6E)-1-amino-4-ethenyl-6-(2-propylpentylsulfanyl)octa-4,6-dien-3-ol (PubChem CID 155329114) has the molecular formula C18H33NOS and a molecular weight of 311.54 g/mol. Its IUPAC name is (4E,6E)-1-amino-4-ethenyl-6-(2-propylpentylsulfanyl)octa-4,6-dien-3-ol.
| Compound Name | (4E,6E)-1-amino-4-ethenyl-6-(2-propylpentylsulfanyl)octa-4,6-dien-3-ol |
|---|---|
| PubChem CID | 155329114 |
| Molecular Formula | C18H33NOS |
| Molecular Weight | 311.54 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | (4E,6E)-1-amino-4-ethenyl-6-(2-propylpentylsulfanyl)octa-4,6-dien-3-ol |
| SMILES | C=C/C(=C\C(=C/C)SCC(CCC)CCC)C(O)CCN |
| InChI | InChI=1S/C18H33NOS/c1-5-9-15(10-6-2)14-21-17(8-4)13-16(7-3)18(20)11-12-19/h7-8,13,15,18,20H,3,5-6,9-12,14,19H2,1-2,4H3/b16-13+,17-8+ |
| InChIKey | IUHDKPOIQMMTGD-WXUGCJNMSA-N |
| XLogP | 4.66 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|