About 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine
1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine (PubChem CID 155329346) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine.
Molecular Properties
| Compound Name | 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine |
| PubChem CID | 155329346 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine |
| SMILES | C=N/C=C\N=C\[C@H]1C=CC=CCC1 |
| InChI | InChI=1S/C11H14N2/c1-12-8-9-13-10-11-6-4-2-3-5-7-11/h2-4,6,8-11H,1,5,7H2/b9-8-,13-10+/t11-/m0/s1 |
| InChIKey | PJHUUUTWZZVVHG-ZMRYWAQCSA-N |
| XLogP | 2.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine?
The IUPAC name of 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine (CID 155329346) is 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine.
What is the SMILES notation for 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine?
The canonical SMILES for 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine is C=N/C=C\N=C\[C@H]1C=CC=CCC1.
What is the InChIKey of 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine?
The InChIKey is PJHUUUTWZZVVHG-ZMRYWAQCSA-N. The full InChI is InChI=1S/C11H14N2/c1-12-8-9-13-10-11-6-4-2-3-5-7-11/h2-4,6,8-11H,1,5,7H2/b9-8-,13-10+/t11-/m0/s1.
What are the key properties of 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine?
1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine has a molecular weight of 174.25 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-cyclohepta-2,4-dien-1-yl]-N-[(Z)-2-(methylideneamino)ethenyl]methanimine is sourced from PubChem (CID 155329346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).