About 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione
4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 155329829) has the molecular formula C22H14N2O2S2
and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione |
| PubChem CID | 155329829 |
| Molecular Formula | C22H14N2O2S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | O=C1C(=C2Sc3ccccc3S2)C(=O)N(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H14N2O2S2/c25-20-19(22-27-17-13-7-8-14-18(17)28-22)21(26)24(16-11-5-2-6-12-16)23(20)15-9-3-1-4-10-15/h1-14H |
| InChIKey | KSSZNUSFJWVMKC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione?
The IUPAC name of 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione (CID 155329829) is 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione.
What is the SMILES notation for 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione?
The canonical SMILES for 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione is O=C1C(=C2Sc3ccccc3S2)C(=O)N(c2ccccc2)N1c1ccccc1.
What is the InChIKey of 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione?
The InChIKey is KSSZNUSFJWVMKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N2O2S2/c25-20-19(22-27-17-13-7-8-14-18(17)28-22)21(26)24(16-11-5-2-6-12-16)23(20)15-9-3-1-4-10-15/h1-14H.
What are the key properties of 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione?
4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione has a molecular weight of 402.50 g/mol, XLogP of 5.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodithiol-2-ylidene)-1,2-diphenylpyrazolidine-3,5-dione is sourced from PubChem (CID 155329829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).