About (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine
(Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine (PubChem CID 155330035) has the molecular formula C9H17F2N3
and a molecular weight of 205.25 g/mol. Its IUPAC name is (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine |
| PubChem CID | 155330035 |
| Molecular Formula | C9H17F2N3 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine |
| SMILES | C/C(N)=C/NC1CN(C)CC(F)(F)C1 |
| InChI | InChI=1S/C9H17F2N3/c1-7(12)4-13-8-3-9(10,11)6-14(2)5-8/h4,8,13H,3,5-6,12H2,1-2H3/b7-4- |
| InChIKey | GZMUBESENJHZAU-DAXSKMNVSA-N |
| XLogP | 0.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine?
The IUPAC name of (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine (CID 155330035) is (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine?
The canonical SMILES for (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine is C/C(N)=C/NC1CN(C)CC(F)(F)C1.
What is the InChIKey of (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine?
The InChIKey is GZMUBESENJHZAU-DAXSKMNVSA-N. The full InChI is InChI=1S/C9H17F2N3/c1-7(12)4-13-8-3-9(10,11)6-14(2)5-8/h4,8,13H,3,5-6,12H2,1-2H3/b7-4-.
What are the key properties of (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine?
(Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine has a molecular weight of 205.25 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N-(5,5-difluoro-1-methylpiperidin-3-yl)prop-1-ene-1,2-diamine is sourced from PubChem (CID 155330035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).