C26H36N4O3 — CID 155330147
(2S,5S,8S)-14-methoxy-2-(2-methylpropyl)-5-(2-piperidin-1-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 155330147) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is (2S,5S,8S)-14-methoxy-2-(2-methylpropyl)-5-(2-piperidin-1-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2S,5S,8S)-14-methoxy-2-(2-methylpropyl)-5-(2-piperidin-1-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 155330147 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | (2S,5S,8S)-14-methoxy-2-(2-methylpropyl)-5-(2-piperidin-1-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc2c3c([nH]c2c1)[C@H](CC(C)C)N1C(=O)[C@H](CCN2CCCCC2)NC(=O)[C@@H]1C3 |
| InChI | InChI=1S/C26H36N4O3/c1-16(2)13-22-24-19(18-8-7-17(33-3)14-21(18)27-24)15-23-25(31)28-20(26(32)30(22)23)9-12-29-10-5-4-6-11-29/h7-8,14,16,20,22-23,27H,4-6,9-13,15H2,1-3H3,(H,28,31)/t20-,22-,23-/m0/s1 |
| InChIKey | ZKHDJLRGIHBVBN-PMVMPFDFSA-N |
| XLogP | 3.39 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|