C26H34N4O4 — CID 155330151
14-methoxy-2-(2-methylpropyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 155330151) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 14-methoxy-2-(2-methylpropyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 14-methoxy-2-(2-methylpropyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 155330151 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 14-methoxy-2-(2-methylpropyl)-5-(2-oxo-2-piperidin-1-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc2c3c([nH]c2c1)C(CC(C)C)N1C(=O)C(CC(=O)N2CCCCC2)NC(=O)C1C3 |
| InChI | InChI=1S/C26H34N4O4/c1-15(2)11-21-24-18(17-8-7-16(34-3)12-19(17)27-24)13-22-25(32)28-20(26(33)30(21)22)14-23(31)29-9-5-4-6-10-29/h7-8,12,15,20-22,27H,4-6,9-11,13-14H2,1-3H3,(H,28,32) |
| InChIKey | MLATYQUWOMACKU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|