C16H29N — CID 155330624
N-[(5E)-4-ethyl-3,4,5-trimethylocta-5,7-dien-3-yl]propan-2-imine (PubChem CID 155330624) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is N-[(5E)-4-ethyl-3,4,5-trimethylocta-5,7-dien-3-yl]propan-2-imine.
| Compound Name | N-[(5E)-4-ethyl-3,4,5-trimethylocta-5,7-dien-3-yl]propan-2-imine |
|---|---|
| PubChem CID | 155330624 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | N-[(5E)-4-ethyl-3,4,5-trimethylocta-5,7-dien-3-yl]propan-2-imine |
| SMILES | C=C/C=C(\C)C(C)(CC)C(C)(CC)N=C(C)C |
| InChI | InChI=1S/C16H29N/c1-9-12-14(6)15(7,10-2)16(8,11-3)17-13(4)5/h9,12H,1,10-11H2,2-8H3/b14-12+ |
| InChIKey | VFTVOIUWWKRMLS-WYMLVPIESA-N |
| XLogP | 5.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|