C22H33N — CID 155330630
2-[6-(3,4-dimethyloct-5-en-4-yl)-3-methylcyclohexa-1,3-dien-1-yl]-1,2-dihydropyridine (PubChem CID 155330630) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is 2-[6-(3,4-dimethyloct-5-en-4-yl)-3-methylcyclohexa-1,3-dien-1-yl]-1,2-dihydropyridine.
| Compound Name | 2-[6-(3,4-dimethyloct-5-en-4-yl)-3-methylcyclohexa-1,3-dien-1-yl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 155330630 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 2-[6-(3,4-dimethyloct-5-en-4-yl)-3-methylcyclohexa-1,3-dien-1-yl]-1,2-dihydropyridine |
| SMILES | CCC=CC(C)(C(C)CC)C1CC=C(C)C=C1C1C=CC=CN1 |
| InChI | InChI=1S/C22H33N/c1-6-8-14-22(5,18(4)7-2)20-13-12-17(3)16-19(20)21-11-9-10-15-23-21/h8-12,14-16,18,20-21,23H,6-7,13H2,1-5H3 |
| InChIKey | YEJLLCFGLHWKOI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|