C36H51Cl2N7O7 — CID 155330903
methyl 3-[4-(8-azidooctoxy)-3,5-dichlorophenyl]-3-[[2-[5-[(2-methylpropan-2-yl)oxycarbonyl-(4-methyl-2-pyridinyl)amino]pentanoylamino]acetyl]amino]propanoate (PubChem CID 155330903) has the molecular formula C36H51Cl2N7O7 and a molecular weight of 764.75 g/mol. Its IUPAC name is methyl 3-[4-(8-azidooctoxy)-3,5-dichlorophenyl]-3-[[2-[5-[(2-methylpropan-2-yl)oxycarbonyl-(4-methyl-2-pyridinyl)amino]pentanoylamino]acetyl]amino]propanoate.
| Compound Name | methyl 3-[4-(8-azidooctoxy)-3,5-dichlorophenyl]-3-[[2-[5-[(2-methylpropan-2-yl)oxycarbonyl-(4-methyl-2-pyridinyl)amino]pentanoylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 155330903 |
| Molecular Formula | C36H51Cl2N7O7 |
| Molecular Weight | 764.75 g/mol |
| Exact Mass | 763.32 |
| IUPAC Name | methyl 3-[4-(8-azidooctoxy)-3,5-dichlorophenyl]-3-[[2-[5-[(2-methylpropan-2-yl)oxycarbonyl-(4-methyl-2-pyridinyl)amino]pentanoylamino]acetyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CNC(=O)CCCCN(C(=O)OC(C)(C)C)c1cc(C)ccn1)c1cc(Cl)c(OCCCCCCCCN=[N+]=[N-])c(Cl)c1 |
| InChI | InChI=1S/C36H51Cl2N7O7/c1-25-15-17-40-30(20-25)45(35(49)52-36(2,3)4)18-12-10-14-31(46)41-24-32(47)43-29(23-33(48)50-5)26-21-27(37)34(28(38)22-26)51-19-13-9-7-6-8-11-16-42-44-39/h15,17,20-22,29H,6-14,16,18-19,23-24H2,1-5H3,(H,41,46)(H,43,47) |
| InChIKey | PVPFABLVGVGHMY-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 184.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.75 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|