C7H7F3N4OS — CID 155331103
3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbothioic S-acid (PubChem CID 155331103) has the molecular formula C7H7F3N4OS and a molecular weight of 252.22 g/mol. Its IUPAC name is 3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbothioic S-acid.
| Compound Name | 3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbothioic S-acid |
|---|---|
| PubChem CID | 155331103 |
| Molecular Formula | C7H7F3N4OS |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbothioic S-acid |
| SMILES | O=C(S)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C7H7F3N4OS/c8-7(9,10)5-12-11-4-3-13(6(15)16)1-2-14(4)5/h1-3H2,(H,15,16) |
| InChIKey | VCFUJEIHXYNKIV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 51.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|