C28H48N6O9 — CID 155331118
methyl (2S)-3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-[5-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-(4-methyl-2-pyridinyl)amino]pentanoylamino]propanoate (PubChem CID 155331118) has the molecular formula C28H48N6O9 and a molecular weight of 612.73 g/mol. Its IUPAC name is methyl (2S)-3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-[5-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-(4-methyl-2-pyridinyl)amino]pentanoylamino]propanoate.
| Compound Name | methyl (2S)-3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-[5-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-(4-methyl-2-pyridinyl)amino]pentanoylamino]propanoate |
|---|---|
| PubChem CID | 155331118 |
| Molecular Formula | C28H48N6O9 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | methyl (2S)-3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-[5-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-(4-methyl-2-pyridinyl)amino]pentanoylamino]propanoate |
| SMILES | COC(=O)[C@H](COCCOCCOCCOCCN=[N+]=[N-])NC(=O)CCCCN(c1cc(C)ccn1)C(O)OC(C)(C)C |
| InChI | InChI=1S/C28H48N6O9/c1-22-9-10-30-24(20-22)34(27(37)43-28(2,3)4)12-7-6-8-25(35)32-23(26(36)38-5)21-42-19-18-41-17-16-40-15-14-39-13-11-31-33-29/h9-10,20,23,27,37H,6-8,11-19,21H2,1-5H3,(H,32,35)/t23-,27?/m0/s1 |
| InChIKey | UPIIPIAEFIOCNH-DCCUJTHKSA-N |
| XLogP | 2.49 |
| TPSA | 186.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|