C16H25NO8P2 — CID 155331166
[(4aR,10aR)-6-phosphonooxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl] dihydrogen phosphate (PubChem CID 155331166) has the molecular formula C16H25NO8P2 and a molecular weight of 421.32 g/mol. Its IUPAC name is [(4aR,10aR)-6-phosphonooxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl] dihydrogen phosphate.
| Compound Name | [(4aR,10aR)-6-phosphonooxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155331166 |
| Molecular Formula | C16H25NO8P2 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [(4aR,10aR)-6-phosphonooxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl] dihydrogen phosphate |
| SMILES | CCCN1CCC[C@@H]2Cc3c(ccc(OP(=O)(O)O)c3OP(=O)(O)O)C[C@H]21 |
| InChI | InChI=1S/C16H25NO8P2/c1-2-7-17-8-3-4-12-9-13-11(10-14(12)17)5-6-15(24-26(18,19)20)16(13)25-27(21,22)23/h5-6,12,14H,2-4,7-10H2,1H3,(H2,18,19,20)(H2,21,22,23)/t12-,14-/m1/s1 |
| InChIKey | RFIYEROCYIAXGQ-TZMCWYRMSA-N |
| XLogP | 2.22 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|