C14H16N4O4 — CID 155331355
(4Z)-1-(2,6-dioxopiperidin-3-yl)-4-[(ethylideneamino)methylidene]-3-methyliminopiperidine-2,6-dione (PubChem CID 155331355) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is (4Z)-1-(2,6-dioxopiperidin-3-yl)-4-[(ethylideneamino)methylidene]-3-methyliminopiperidine-2,6-dione.
| Compound Name | (4Z)-1-(2,6-dioxopiperidin-3-yl)-4-[(ethylideneamino)methylidene]-3-methyliminopiperidine-2,6-dione |
|---|---|
| PubChem CID | 155331355 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (4Z)-1-(2,6-dioxopiperidin-3-yl)-4-[(ethylideneamino)methylidene]-3-methyliminopiperidine-2,6-dione |
| SMILES | C/C=N/C=C1/CC(=O)N(C2CCC(=O)NC2=O)C(=O)/C1=N\C |
| InChI | InChI=1S/C14H16N4O4/c1-3-16-7-8-6-11(20)18(14(22)12(8)15-2)9-4-5-10(19)17-13(9)21/h3,7,9H,4-6H2,1-2H3,(H,17,19,21)/b8-7-,15-12-,16-3+ |
| InChIKey | DIWSPJYZWVDKQE-JGVUQVOWSA-N |
| XLogP | -0.40 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|