C20H24FN3O5 — CID 155331461
[3-[(3E,4E)-4-[(E)-but-2-enylidene]-3-(2-fluoroprop-2-enylidene)-2-oxopyrrolidin-1-yl]-2,6-dioxopiperidin-1-yl]methyl N-ethylcarbamate (PubChem CID 155331461) has the molecular formula C20H24FN3O5 and a molecular weight of 405.43 g/mol. Its IUPAC name is [3-[(3E,4E)-4-[(E)-but-2-enylidene]-3-(2-fluoroprop-2-enylidene)-2-oxopyrrolidin-1-yl]-2,6-dioxopiperidin-1-yl]methyl N-ethylcarbamate.
| Compound Name | [3-[(3E,4E)-4-[(E)-but-2-enylidene]-3-(2-fluoroprop-2-enylidene)-2-oxopyrrolidin-1-yl]-2,6-dioxopiperidin-1-yl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 155331461 |
| Molecular Formula | C20H24FN3O5 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [3-[(3E,4E)-4-[(E)-but-2-enylidene]-3-(2-fluoroprop-2-enylidene)-2-oxopyrrolidin-1-yl]-2,6-dioxopiperidin-1-yl]methyl N-ethylcarbamate |
| SMILES | C=C(F)/C=C1/C(=O)N(C2CCC(=O)N(COC(=O)NCC)C2=O)C/C1=C/C=C/C |
| InChI | InChI=1S/C20H24FN3O5/c1-4-6-7-14-11-23(18(26)15(14)10-13(3)21)16-8-9-17(25)24(19(16)27)12-29-20(28)22-5-2/h4,6-7,10,16H,3,5,8-9,11-12H2,1-2H3,(H,22,28)/b6-4+,14-7-,15-10+ |
| InChIKey | GSHNYIOSQFYEPG-HWCNQEEPSA-N |
| XLogP | 1.96 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|