C29H36N4O4 — CID 155331778
tert-butyl 2-[5-(N-(3,5-dimethyl-1,2-benzoxazol-6-yl)-4-imidazol-1-ylanilino)pentoxy]acetate (PubChem CID 155331778) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is tert-butyl 2-[5-(N-(3,5-dimethyl-1,2-benzoxazol-6-yl)-4-imidazol-1-ylanilino)pentoxy]acetate.
| Compound Name | tert-butyl 2-[5-(N-(3,5-dimethyl-1,2-benzoxazol-6-yl)-4-imidazol-1-ylanilino)pentoxy]acetate |
|---|---|
| PubChem CID | 155331778 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | tert-butyl 2-[5-(N-(3,5-dimethyl-1,2-benzoxazol-6-yl)-4-imidazol-1-ylanilino)pentoxy]acetate |
| SMILES | Cc1cc2c(C)noc2cc1N(CCCCCOCC(=O)OC(C)(C)C)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C29H36N4O4/c1-21-17-25-22(2)31-37-27(25)18-26(21)33(24-11-9-23(10-12-24)32-15-13-30-20-32)14-7-6-8-16-35-19-28(34)36-29(3,4)5/h9-13,15,17-18,20H,6-8,14,16,19H2,1-5H3 |
| InChIKey | ZWVRYWYWALBKRP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 82.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|