C42H48N6O4 — CID 155332015
2-(6-amino-3-oxo-1H-isoindol-2-yl)-N-[6-[4-(1-cyanocyclopropyl)-N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]anilino]hexyl]-N-methyl-5-oxopentanamide (PubChem CID 155332015) has the molecular formula C42H48N6O4 and a molecular weight of 700.88 g/mol. Its IUPAC name is 2-(6-amino-3-oxo-1H-isoindol-2-yl)-N-[6-[4-(1-cyanocyclopropyl)-N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]anilino]hexyl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-(6-amino-3-oxo-1H-isoindol-2-yl)-N-[6-[4-(1-cyanocyclopropyl)-N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]anilino]hexyl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 155332015 |
| Molecular Formula | C42H48N6O4 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.37 |
| IUPAC Name | 2-(6-amino-3-oxo-1H-isoindol-2-yl)-N-[6-[4-(1-cyanocyclopropyl)-N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]anilino]hexyl]-N-methyl-5-oxopentanamide |
| SMILES | Cc1ccc(-c2c(C)noc2C)cc1N(CCCCCCN(C)C(=O)C(CCC=O)N1Cc2cc(N)ccc2C1=O)c1ccc(C2(C#N)CC2)cc1 |
| InChI | InChI=1S/C42H48N6O4/c1-28-11-12-31(39-29(2)45-52-30(39)3)25-38(28)47(35-16-13-33(14-17-35)42(27-43)19-20-42)22-8-6-5-7-21-46(4)41(51)37(10-9-23-49)48-26-32-24-34(44)15-18-36(32)40(48)50/h11-18,23-25,37H,5-10,19-22,26,44H2,1-4H3 |
| InChIKey | VLETZUKFWKSNRP-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|