C22H24FN9O10P2S — CID 155332196
9-[17-(6-aminopurin-9-yl)-7-fluoro-4,13,16-trihydroxy-4-oxo-13-sulfanylidene-3,5,9,12,14-pentaoxa-4λ5,13λ5-diphosphatetracyclo[13.4.0.01,18.06,10]nonadecan-8-yl]-1H-purin-6-one (PubChem CID 155332196) has the molecular formula C22H24FN9O10P2S and a molecular weight of 687.50 g/mol. Its IUPAC name is 9-[17-(6-aminopurin-9-yl)-7-fluoro-4,13,16-trihydroxy-4-oxo-13-sulfanylidene-3,5,9,12,14-pentaoxa-4λ5,13λ5-diphosphatetracyclo[13.4.0.01,18.06,10]nonadecan-8-yl]-1H-purin-6-one.
| Compound Name | 9-[17-(6-aminopurin-9-yl)-7-fluoro-4,13,16-trihydroxy-4-oxo-13-sulfanylidene-3,5,9,12,14-pentaoxa-4λ5,13λ5-diphosphatetracyclo[13.4.0.01,18.06,10]nonadecan-8-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155332196 |
| Molecular Formula | C22H24FN9O10P2S |
| Molecular Weight | 687.50 g/mol |
| Exact Mass | 687.08 |
| IUPAC Name | 9-[17-(6-aminopurin-9-yl)-7-fluoro-4,13,16-trihydroxy-4-oxo-13-sulfanylidene-3,5,9,12,14-pentaoxa-4λ5,13λ5-diphosphatetracyclo[13.4.0.01,18.06,10]nonadecan-8-yl]-1H-purin-6-one |
| SMILES | Nc1ncnc2c1ncn2C1C(O)C2OP(O)(=S)OCC3OC(n4cnc5c(=O)[nH]cnc54)C(F)C3OP(=O)(O)OCC23CC13 |
| InChI | InChI=1S/C22H24FN9O10P2S/c23-10-15-9(40-21(10)32-7-30-12-19(32)27-5-28-20(12)34)2-38-44(37,45)42-16-14(33)13(8-1-22(8,16)3-39-43(35,36)41-15)31-6-29-11-17(24)25-4-26-18(11)31/h4-10,13-16,21,33H,1-3H2,(H,35,36)(H,37,45)(H2,24,25,26)(H,27,28,34) |
| InChIKey | VDEMDGUVCQFUPP-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 257.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.50 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|