About 1-cyano-N'-ethyl-N-methylidenemethanimidamide
1-cyano-N'-ethyl-N-methylidenemethanimidamide (PubChem CID 155332325) has the molecular formula C5H7N3
and a molecular weight of 109.13 g/mol. Its IUPAC name is 1-cyano-N'-ethyl-N-methylidenemethanimidamide.
Molecular Properties
| Compound Name | 1-cyano-N'-ethyl-N-methylidenemethanimidamide |
| PubChem CID | 155332325 |
| Molecular Formula | C5H7N3 |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.06 |
| IUPAC Name | 1-cyano-N'-ethyl-N-methylidenemethanimidamide |
| SMILES | C=N/C(C#N)=N/CC |
| InChI | InChI=1S/C5H7N3/c1-3-8-5(4-6)7-2/h2-3H2,1H3/b8-5+ |
| InChIKey | WHFZZLMUUCQKLN-VMPITWQZSA-N |
| XLogP | 0.63 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-N'-ethyl-N-methylidenemethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N'-ethyl-N-methylidenemethanimidamide?
The IUPAC name of 1-cyano-N'-ethyl-N-methylidenemethanimidamide (CID 155332325) is 1-cyano-N'-ethyl-N-methylidenemethanimidamide.
What is the SMILES notation for 1-cyano-N'-ethyl-N-methylidenemethanimidamide?
The canonical SMILES for 1-cyano-N'-ethyl-N-methylidenemethanimidamide is C=N/C(C#N)=N/CC.
What is the InChIKey of 1-cyano-N'-ethyl-N-methylidenemethanimidamide?
The InChIKey is WHFZZLMUUCQKLN-VMPITWQZSA-N. The full InChI is InChI=1S/C5H7N3/c1-3-8-5(4-6)7-2/h2-3H2,1H3/b8-5+.
What are the key properties of 1-cyano-N'-ethyl-N-methylidenemethanimidamide?
1-cyano-N'-ethyl-N-methylidenemethanimidamide has a molecular weight of 109.13 g/mol, XLogP of 0.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N'-ethyl-N-methylidenemethanimidamide is sourced from PubChem (CID 155332325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).