About 4-bromo-1,6-dimethylbenzimidazol-5-amine
4-bromo-1,6-dimethylbenzimidazol-5-amine (PubChem CID 155332352) has the molecular formula C9H10BrN3
and a molecular weight of 240.10 g/mol. Its IUPAC name is 4-bromo-1,6-dimethylbenzimidazol-5-amine.
Molecular Properties
| Compound Name | 4-bromo-1,6-dimethylbenzimidazol-5-amine |
| PubChem CID | 155332352 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 4-bromo-1,6-dimethylbenzimidazol-5-amine |
| SMILES | Cc1cc2c(ncn2C)c(Br)c1N |
| InChI | InChI=1S/C9H10BrN3/c1-5-3-6-9(7(10)8(5)11)12-4-13(6)2/h3-4H,11H2,1-2H3 |
| InChIKey | REWGJMYCVWQNKU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,6-dimethylbenzimidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,6-dimethylbenzimidazol-5-amine?
The IUPAC name of 4-bromo-1,6-dimethylbenzimidazol-5-amine (CID 155332352) is 4-bromo-1,6-dimethylbenzimidazol-5-amine.
What is the SMILES notation for 4-bromo-1,6-dimethylbenzimidazol-5-amine?
The canonical SMILES for 4-bromo-1,6-dimethylbenzimidazol-5-amine is Cc1cc2c(ncn2C)c(Br)c1N.
What is the InChIKey of 4-bromo-1,6-dimethylbenzimidazol-5-amine?
The InChIKey is REWGJMYCVWQNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN3/c1-5-3-6-9(7(10)8(5)11)12-4-13(6)2/h3-4H,11H2,1-2H3.
What are the key properties of 4-bromo-1,6-dimethylbenzimidazol-5-amine?
4-bromo-1,6-dimethylbenzimidazol-5-amine has a molecular weight of 240.10 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,6-dimethylbenzimidazol-5-amine is sourced from PubChem (CID 155332352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).