C22H22O5 — CID 15533454
ethyl 5-ethoxycarbonyloxy-5,5-diphenylpent-2-ynoate (PubChem CID 15533454) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is ethyl 5-ethoxycarbonyloxy-5,5-diphenylpent-2-ynoate.
| Compound Name | ethyl 5-ethoxycarbonyloxy-5,5-diphenylpent-2-ynoate |
|---|---|
| PubChem CID | 15533454 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | ethyl 5-ethoxycarbonyloxy-5,5-diphenylpent-2-ynoate |
| SMILES | CCOC(=O)C#CCC(OC(=O)OCC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22O5/c1-3-25-20(23)16-11-17-22(27-21(24)26-4-2,18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-10,12-15H,3-4,17H2,1-2H3 |
| InChIKey | KSSAEEGZDDPWBC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|