About methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate
methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate (PubChem CID 155336796) has the molecular formula C16H18O3
and a molecular weight of 258.32 g/mol. Its IUPAC name is methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate |
| PubChem CID | 155336796 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate |
| SMILES | COC(=O)C1C[C@]2(CCc3ccccc3C2)CC1=O |
| InChI | InChI=1S/C16H18O3/c1-19-15(18)13-9-16(10-14(13)17)7-6-11-4-2-3-5-12(11)8-16/h2-5,13H,6-10H2,1H3/t13?,16-/m1/s1 |
| InChIKey | SDZGCIGPGJLLPF-FQNRMIAFSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate?
The IUPAC name of methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate (CID 155336796) is methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate.
What is the SMILES notation for methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate?
The canonical SMILES for methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate is COC(=O)C1C[C@]2(CCc3ccccc3C2)CC1=O.
What is the InChIKey of methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate?
The InChIKey is SDZGCIGPGJLLPF-FQNRMIAFSA-N. The full InChI is InChI=1S/C16H18O3/c1-19-15(18)13-9-16(10-14(13)17)7-6-11-4-2-3-5-12(11)8-16/h2-5,13H,6-10H2,1H3/t13?,16-/m1/s1.
What are the key properties of methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate?
methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate has a molecular weight of 258.32 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-2'-oxospiro[2,4-dihydro-1H-naphthalene-3,4'-cyclopentane]-1'-carboxylate is sourced from PubChem (CID 155336796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).