About 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene
1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene (PubChem CID 155337072) has the molecular formula C12H4Cl4F2O6S3
and a molecular weight of 520.17 g/mol. Its IUPAC name is 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene.
Molecular Properties
| Compound Name | 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene |
| PubChem CID | 155337072 |
| Molecular Formula | C12H4Cl4F2O6S3 |
| Molecular Weight | 520.17 g/mol |
| Exact Mass | 517.79 |
| IUPAC Name | 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene |
| SMILES | O=S(=O)(F)Oc1c(Cl)cc(Cl)cc1Sc1cc(Cl)cc(Cl)c1OS(=O)(=O)F |
| InChI | InChI=1S/C12H4Cl4F2O6S3/c13-5-1-7(15)11(23-26(17,19)20)9(3-5)25-10-4-6(14)2-8(16)12(10)24-27(18,21)22/h1-4H |
| InChIKey | WOSFEGFKIVFMIC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.17 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene?
The IUPAC name of 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene (CID 155337072) is 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene.
What is the SMILES notation for 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene?
The canonical SMILES for 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene is O=S(=O)(F)Oc1c(Cl)cc(Cl)cc1Sc1cc(Cl)cc(Cl)c1OS(=O)(=O)F.
What is the InChIKey of 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene?
The InChIKey is WOSFEGFKIVFMIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Cl4F2O6S3/c13-5-1-7(15)11(23-26(17,19)20)9(3-5)25-10-4-6(14)2-8(16)12(10)24-27(18,21)22/h1-4H.
What are the key properties of 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene?
1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene has a molecular weight of 520.17 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dichloro-3-(3,5-dichloro-2-fluorosulfonyloxyphenyl)sulfanyl-2-fluorosulfonyloxybenzene is sourced from PubChem (CID 155337072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).