About N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide
N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide (PubChem CID 15533711) has the molecular formula C14H17NO3S
and a molecular weight of 279.36 g/mol. Its IUPAC name is N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide |
| PubChem CID | 15533711 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide |
| SMILES | C=C=CCN(CCC=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H17NO3S/c1-3-4-10-15(11-5-12-16)19(17,18)14-8-6-13(2)7-9-14/h4,6-9,12H,1,5,10-11H2,2H3 |
| InChIKey | BNPUDWWSBWBLAT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide?
The IUPAC name of N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide (CID 15533711) is N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide.
What is the SMILES notation for N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide?
The canonical SMILES for N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide is C=C=CCN(CCC=O)S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide?
The InChIKey is BNPUDWWSBWBLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S/c1-3-4-10-15(11-5-12-16)19(17,18)14-8-6-13(2)7-9-14/h4,6-9,12H,1,5,10-11H2,2H3.
What are the key properties of N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide?
N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide has a molecular weight of 279.36 g/mol, XLogP of 1.92, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-2,3-dienyl-4-methyl-N-(3-oxopropyl)benzenesulfonamide is sourced from PubChem (CID 15533711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).