C26H36FNS — CID 155337301
(3E,5E,8E)-N-butyl-5-[(E)-3-fluoroprop-2-enylidene]-3,8-dimethyl-N-pent-4-enyl-9-prop-1-en-2-ylsulfanylnona-1,3,8-trien-6-yn-2-amine (PubChem CID 155337301) has the molecular formula C26H36FNS and a molecular weight of 413.65 g/mol. Its IUPAC name is (3E,5E,8E)-N-butyl-5-[(E)-3-fluoroprop-2-enylidene]-3,8-dimethyl-N-pent-4-enyl-9-prop-1-en-2-ylsulfanylnona-1,3,8-trien-6-yn-2-amine.
| Compound Name | (3E,5E,8E)-N-butyl-5-[(E)-3-fluoroprop-2-enylidene]-3,8-dimethyl-N-pent-4-enyl-9-prop-1-en-2-ylsulfanylnona-1,3,8-trien-6-yn-2-amine |
|---|---|
| PubChem CID | 155337301 |
| Molecular Formula | C26H36FNS |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | (3E,5E,8E)-N-butyl-5-[(E)-3-fluoroprop-2-enylidene]-3,8-dimethyl-N-pent-4-enyl-9-prop-1-en-2-ylsulfanylnona-1,3,8-trien-6-yn-2-amine |
| SMILES | C=CCCCN(CCCC)C(=C)/C(C)=C/C(C#C/C(C)=C/SC(=C)C)=C\C=C\F |
| InChI | InChI=1S/C26H36FNS/c1-8-10-12-19-28(18-11-9-2)25(7)24(6)20-26(14-13-17-27)16-15-23(5)21-29-22(3)4/h8,13-14,17,20-21H,1,3,7,9-12,18-19H2,2,4-6H3/b17-13+,23-21+,24-20+,26-14- |
| InChIKey | GXKAEBCZFDPGJT-PTQWFRJESA-N |
| XLogP | 8.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|