C13H7F3IN3O — CID 155338075
8-iodo-2-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyrimidine (PubChem CID 155338075) has the molecular formula C13H7F3IN3O and a molecular weight of 405.12 g/mol. Its IUPAC name is 8-iodo-2-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyrimidine.
| Compound Name | 8-iodo-2-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 155338075 |
| Molecular Formula | C13H7F3IN3O |
| Molecular Weight | 405.12 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | 8-iodo-2-[4-(trifluoromethoxy)phenyl]imidazo[1,5-a]pyrimidine |
| SMILES | FC(F)(F)Oc1ccc(-c2ccn3cnc(I)c3n2)cc1 |
| InChI | InChI=1S/C13H7F3IN3O/c14-13(15,16)21-9-3-1-8(2-4-9)10-5-6-20-7-18-11(17)12(20)19-10/h1-7H |
| InChIKey | ANFYUEVRDCFWNW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.12 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|