About 2-methylimidazo[1,2-a]pyridin-3-amine
2-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 15533833) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-methylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-methylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 15533833 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 2-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1nc2ccccn2c1N |
| InChI | InChI=1S/C8H9N3/c1-6-8(9)11-5-3-2-4-7(11)10-6/h2-5H,9H2,1H3 |
| InChIKey | KTIGGQXUSNNTRK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 2-methylimidazo[1,2-a]pyridin-3-amine (CID 15533833) is 2-methylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 2-methylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 2-methylimidazo[1,2-a]pyridin-3-amine is Cc1nc2ccccn2c1N.
What is the InChIKey of 2-methylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is KTIGGQXUSNNTRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-6-8(9)11-5-3-2-4-7(11)10-6/h2-5H,9H2,1H3.
What are the key properties of 2-methylimidazo[1,2-a]pyridin-3-amine?
2-methylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 147.18 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 15533833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).