About 1-(2-chlorophenyl)propyl carbamate
1-(2-chlorophenyl)propyl carbamate (PubChem CID 15534) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is 1-(2-chlorophenyl)propyl carbamate.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)propyl carbamate |
| PubChem CID | 15534 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-(2-chlorophenyl)propyl carbamate |
| SMILES | CCC(OC(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C10H12ClNO2/c1-2-9(14-10(12)13)7-5-3-4-6-8(7)11/h3-6,9H,2H2,1H3,(H2,12,13) |
| InChIKey | VCZXDPUECVELRF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-chlorophenyl)propyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)propyl carbamate?
The IUPAC name of 1-(2-chlorophenyl)propyl carbamate (CID 15534) is 1-(2-chlorophenyl)propyl carbamate.
What is the SMILES notation for 1-(2-chlorophenyl)propyl carbamate?
The canonical SMILES for 1-(2-chlorophenyl)propyl carbamate is CCC(OC(N)=O)c1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenyl)propyl carbamate?
The InChIKey is VCZXDPUECVELRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO2/c1-2-9(14-10(12)13)7-5-3-4-6-8(7)11/h3-6,9H,2H2,1H3,(H2,12,13).
What are the key properties of 1-(2-chlorophenyl)propyl carbamate?
1-(2-chlorophenyl)propyl carbamate has a molecular weight of 213.66 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)propyl carbamate is sourced from PubChem (CID 15534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).