C20H15N5OS — CID 155340198
4-[3-(4-aminopyrido[2,3-d]pyrimidin-6-yl)phenyl]-2-(1,3-thiazol-2-yl)but-3-yn-2-ol (PubChem CID 155340198) has the molecular formula C20H15N5OS and a molecular weight of 373.44 g/mol. Its IUPAC name is 4-[3-(4-aminopyrido[2,3-d]pyrimidin-6-yl)phenyl]-2-(1,3-thiazol-2-yl)but-3-yn-2-ol.
| Compound Name | 4-[3-(4-aminopyrido[2,3-d]pyrimidin-6-yl)phenyl]-2-(1,3-thiazol-2-yl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 155340198 |
| Molecular Formula | C20H15N5OS |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-[3-(4-aminopyrido[2,3-d]pyrimidin-6-yl)phenyl]-2-(1,3-thiazol-2-yl)but-3-yn-2-ol |
| SMILES | CC(O)(C#Cc1cccc(-c2cnc3ncnc(N)c3c2)c1)c1nccs1 |
| InChI | InChI=1S/C20H15N5OS/c1-20(26,19-22-7-8-27-19)6-5-13-3-2-4-14(9-13)15-10-16-17(21)24-12-25-18(16)23-11-15/h2-4,7-12,26H,1H3,(H2,21,23,24,25) |
| InChIKey | BIZMOPSESROQJU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|