C7H6ClF3N2O2 — CID 155340363
1-(3-amino-2-chloro-4-pyridinyl)-2,2,2-trifluoroethane-1,1-diol (PubChem CID 155340363) has the molecular formula C7H6ClF3N2O2 and a molecular weight of 242.58 g/mol. Its IUPAC name is 1-(3-amino-2-chloro-4-pyridinyl)-2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 1-(3-amino-2-chloro-4-pyridinyl)-2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 155340363 |
| Molecular Formula | C7H6ClF3N2O2 |
| Molecular Weight | 242.58 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1-(3-amino-2-chloro-4-pyridinyl)-2,2,2-trifluoroethane-1,1-diol |
| SMILES | Nc1c(C(O)(O)C(F)(F)F)ccnc1Cl |
| InChI | InChI=1S/C7H6ClF3N2O2/c8-5-4(12)3(1-2-13-5)6(14,15)7(9,10)11/h1-2,14-15H,12H2 |
| InChIKey | PUKNSBRKWMCMBE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.58 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|