C18H15N5O2S — CID 155340482
3-[2-[3-(7-amino-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 155340482) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 3-[2-[3-(7-amino-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | 3-[2-[3-(7-amino-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 155340482 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-[2-[3-(7-amino-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | CN1CCC(O)(C#Cc2cccc(-c3nc4c(N)ncnc4s3)c2)C1=O |
| InChI | InChI=1S/C18H15N5O2S/c1-23-8-7-18(25,17(23)24)6-5-11-3-2-4-12(9-11)15-22-13-14(19)20-10-21-16(13)26-15/h2-4,9-10,25H,7-8H2,1H3,(H2,19,20,21) |
| InChIKey | CGYSVYQDLMHPPE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|