C19H18N4OS — CID 155340489
1-[2-[3-(7-amino-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-4-methylphenyl]ethynyl]cyclopentan-1-ol (PubChem CID 155340489) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-[2-[3-(7-amino-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-4-methylphenyl]ethynyl]cyclopentan-1-ol.
| Compound Name | 1-[2-[3-(7-amino-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-4-methylphenyl]ethynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 155340489 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-[2-[3-(7-amino-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-4-methylphenyl]ethynyl]cyclopentan-1-ol |
| SMILES | Cc1ccc(C#CC2(O)CCCC2)cc1-c1nc2c(N)ncnc2s1 |
| InChI | InChI=1S/C19H18N4OS/c1-12-4-5-13(6-9-19(24)7-2-3-8-19)10-14(12)17-23-15-16(20)21-11-22-18(15)25-17/h4-5,10-11,24H,2-3,7-8H2,1H3,(H2,20,21,22) |
| InChIKey | DPYYSWMWMJFBRA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|