C24H20N4O — CID 155340520
7-[2-[3-(1-aminoisoquinolin-7-yl)-4-methylphenyl]ethynyl]-5,6-dihydropyrrolo[1,2-a]imidazol-7-ol (PubChem CID 155340520) has the molecular formula C24H20N4O and a molecular weight of 380.45 g/mol. Its IUPAC name is 7-[2-[3-(1-aminoisoquinolin-7-yl)-4-methylphenyl]ethynyl]-5,6-dihydropyrrolo[1,2-a]imidazol-7-ol.
| Compound Name | 7-[2-[3-(1-aminoisoquinolin-7-yl)-4-methylphenyl]ethynyl]-5,6-dihydropyrrolo[1,2-a]imidazol-7-ol |
|---|---|
| PubChem CID | 155340520 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 7-[2-[3-(1-aminoisoquinolin-7-yl)-4-methylphenyl]ethynyl]-5,6-dihydropyrrolo[1,2-a]imidazol-7-ol |
| SMILES | Cc1ccc(C#CC2(O)CCn3ccnc32)cc1-c1ccc2ccnc(N)c2c1 |
| InChI | InChI=1S/C24H20N4O/c1-16-2-3-17(6-8-24(29)9-12-28-13-11-27-23(24)28)14-20(16)19-5-4-18-7-10-26-22(25)21(18)15-19/h2-5,7,10-11,13-15,29H,9,12H2,1H3,(H2,25,26) |
| InChIKey | YZBSRRKBHMQVEU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|