About 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine
8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine (PubChem CID 155340521) has the molecular formula C16H13BrN4
and a molecular weight of 341.21 g/mol. Its IUPAC name is 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine |
| PubChem CID | 155340521 |
| Molecular Formula | C16H13BrN4 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine |
| SMILES | Brc1cccc(-c2ncc3ccnc(N4CCC4)c3n2)c1 |
| InChI | InChI=1S/C16H13BrN4/c17-13-4-1-3-11(9-13)15-19-10-12-5-6-18-16(14(12)20-15)21-7-2-8-21/h1,3-6,9-10H,2,7-8H2 |
| InChIKey | DKXYSUWAXGBPMG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine?
The IUPAC name of 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine (CID 155340521) is 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine.
What is the SMILES notation for 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine?
The canonical SMILES for 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine is Brc1cccc(-c2ncc3ccnc(N4CCC4)c3n2)c1.
What is the InChIKey of 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine?
The InChIKey is DKXYSUWAXGBPMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrN4/c17-13-4-1-3-11(9-13)15-19-10-12-5-6-18-16(14(12)20-15)21-7-2-8-21/h1,3-6,9-10H,2,7-8H2.
What are the key properties of 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine?
8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine has a molecular weight of 341.21 g/mol, XLogP of 3.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(azetidin-1-yl)-2-(3-bromophenyl)pyrido[3,4-d]pyrimidine is sourced from PubChem (CID 155340521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).