C13H12IN3O — CID 155340679
6-(3-iodophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 155340679) has the molecular formula C13H12IN3O and a molecular weight of 353.16 g/mol. Its IUPAC name is 6-(3-iodophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-(3-iodophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155340679 |
| Molecular Formula | C13H12IN3O |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 6-(3-iodophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1CN(c1cccc(I)c1)CC2 |
| InChI | InChI=1S/C13H12IN3O/c14-9-2-1-3-10(6-9)17-5-4-12-11(7-17)13(18)16-8-15-12/h1-3,6,8H,4-5,7H2,(H,15,16,18) |
| InChIKey | JLTWFUOYFBODCO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|