C8H6ClF3N2O4 — CID 155340751
[2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamic acid (PubChem CID 155340751) has the molecular formula C8H6ClF3N2O4 and a molecular weight of 286.59 g/mol. Its IUPAC name is [2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamic acid.
| Compound Name | [2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 155340751 |
| Molecular Formula | C8H6ClF3N2O4 |
| Molecular Weight | 286.59 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | [2-chloro-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-3-pyridinyl]carbamic acid |
| SMILES | O=C(O)Nc1c(C(O)(O)C(F)(F)F)ccnc1Cl |
| InChI | InChI=1S/C8H6ClF3N2O4/c9-5-4(14-6(15)16)3(1-2-13-5)7(17,18)8(10,11)12/h1-2,14,17-18H,(H,15,16) |
| InChIKey | FJLKWCQKVBCKML-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.59 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|