C21H22F8O7 — CID 15534076
diethyl 2,6-dihydroxy-4-phenyl-2,6-bis(1,1,2,2-tetrafluoroethyl)oxane-3,5-dicarboxylate (PubChem CID 15534076) has the molecular formula C21H22F8O7 and a molecular weight of 538.38 g/mol. Its IUPAC name is diethyl 2,6-dihydroxy-4-phenyl-2,6-bis(1,1,2,2-tetrafluoroethyl)oxane-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-dihydroxy-4-phenyl-2,6-bis(1,1,2,2-tetrafluoroethyl)oxane-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15534076 |
| Molecular Formula | C21H22F8O7 |
| Molecular Weight | 538.38 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | diethyl 2,6-dihydroxy-4-phenyl-2,6-bis(1,1,2,2-tetrafluoroethyl)oxane-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)C(C(=O)OCC)C(O)(C(F)(F)C(F)F)OC1(O)C(F)(F)C(F)F |
| InChI | InChI=1S/C21H22F8O7/c1-3-34-14(30)12-11(10-8-6-5-7-9-10)13(15(31)35-4-2)21(33,19(28,29)17(24)25)36-20(12,32)18(26,27)16(22)23/h5-9,11-13,16-17,32-33H,3-4H2,1-2H3 |
| InChIKey | IXXXTNUPMCASAD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|