C19H18F8O7 — CID 15534077
dimethyl 2,6-dihydroxy-4-phenyl-2,6-bis(1,1,2,2-tetrafluoroethyl)oxane-3,5-dicarboxylate (PubChem CID 15534077) has the molecular formula C19H18F8O7 and a molecular weight of 510.33 g/mol. Its IUPAC name is dimethyl 2,6-dihydroxy-4-phenyl-2,6-bis(1,1,2,2-tetrafluoroethyl)oxane-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dihydroxy-4-phenyl-2,6-bis(1,1,2,2-tetrafluoroethyl)oxane-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15534077 |
| Molecular Formula | C19H18F8O7 |
| Molecular Weight | 510.33 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | dimethyl 2,6-dihydroxy-4-phenyl-2,6-bis(1,1,2,2-tetrafluoroethyl)oxane-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(c2ccccc2)C(C(=O)OC)C(O)(C(F)(F)C(F)F)OC1(O)C(F)(F)C(F)F |
| InChI | InChI=1S/C19H18F8O7/c1-32-12(28)10-9(8-6-4-3-5-7-8)11(13(29)33-2)19(31,17(26,27)15(22)23)34-18(10,30)16(24,25)14(20)21/h3-7,9-11,14-15,30-31H,1-2H3 |
| InChIKey | LSVUENHYRCYHIN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|