About (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol
(2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol (PubChem CID 155341021) has the molecular formula C8H9NOS
and a molecular weight of 167.23 g/mol. Its IUPAC name is (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol.
Molecular Properties
| Compound Name | (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol |
| PubChem CID | 155341021 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol |
| SMILES | C#C[C@@](C)(O)c1nc(C)cs1 |
| InChI | InChI=1S/C8H9NOS/c1-4-8(3,10)7-9-6(2)5-11-7/h1,5,10H,2-3H3/t8-/m1/s1 |
| InChIKey | ULIKYCNITLBMGE-MRVPVSSYSA-N |
| XLogP | 1.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol?
The IUPAC name of (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol (CID 155341021) is (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol.
What is the SMILES notation for (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol?
The canonical SMILES for (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol is C#C[C@@](C)(O)c1nc(C)cs1.
What is the InChIKey of (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol?
The InChIKey is ULIKYCNITLBMGE-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H9NOS/c1-4-8(3,10)7-9-6(2)5-11-7/h1,5,10H,2-3H3/t8-/m1/s1.
What are the key properties of (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol?
(2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol has a molecular weight of 167.23 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4-methyl-1,3-thiazol-2-yl)but-3-yn-2-ol is sourced from PubChem (CID 155341021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).