C23H26F3N5O2 — CID 155341251
(5R,11R)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-11-(2-hydroxypropan-2-yl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 155341251) has the molecular formula C23H26F3N5O2 and a molecular weight of 461.49 g/mol. Its IUPAC name is (5R,11R)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-11-(2-hydroxypropan-2-yl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,11R)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-11-(2-hydroxypropan-2-yl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 155341251 |
| Molecular Formula | C23H26F3N5O2 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (5R,11R)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-11-(2-hydroxypropan-2-yl)-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1ccc(F)c(C#N)c1)C(F)(F)CC[C@@H](C(C)(C)O)C3 |
| InChI | InChI=1S/C23H26F3N5O2/c1-13-8-19-17(12-30(13)21(32)28-16-4-5-18(24)14(9-16)10-27)20-23(25,26)7-6-15(22(2,3)33)11-31(20)29-19/h4-5,9,13,15,33H,6-8,11-12H2,1-3H3,(H,28,32)/t13-,15-/m1/s1 |
| InChIKey | BNLZOLADYGZIAK-UKRRQHHQSA-N |
| XLogP | 4.15 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |