C20H20F3N5O2 — CID 155341316
(5R,11S)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 155341316) has the molecular formula C20H20F3N5O2 and a molecular weight of 419.41 g/mol. Its IUPAC name is (5R,11S)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,11S)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 155341316 |
| Molecular Formula | C20H20F3N5O2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (5R,11S)-N-(3-cyano-4-fluorophenyl)-14,14-difluoro-11-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1ccc(F)c(C#N)c1)C(F)(F)CC[C@H](O)C3 |
| InChI | InChI=1S/C20H20F3N5O2/c1-11-6-17-15(18-20(22,23)5-4-14(29)9-28(18)26-17)10-27(11)19(30)25-13-2-3-16(21)12(7-13)8-24/h2-3,7,11,14,29H,4-6,9-10H2,1H3,(H,25,30)/t11-,14+/m1/s1 |
| InChIKey | AVLWRSJNLZQIQH-RISCZKNCSA-N |
| XLogP | 3.12 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |