C18H18F5N5O2 — CID 155341361
(12S)-N-[2-(difluoromethyl)-3-fluoro-4-pyridinyl]-14,14-difluoro-12-hydroxy-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 155341361) has the molecular formula C18H18F5N5O2 and a molecular weight of 431.37 g/mol. Its IUPAC name is (12S)-N-[2-(difluoromethyl)-3-fluoro-4-pyridinyl]-14,14-difluoro-12-hydroxy-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (12S)-N-[2-(difluoromethyl)-3-fluoro-4-pyridinyl]-14,14-difluoro-12-hydroxy-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 155341361 |
| Molecular Formula | C18H18F5N5O2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (12S)-N-[2-(difluoromethyl)-3-fluoro-4-pyridinyl]-14,14-difluoro-12-hydroxy-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | O=C(Nc1ccnc(C(F)F)c1F)N1CCc2nn3c(c2C1)C(F)(F)C[C@@H](O)CC3 |
| InChI | InChI=1S/C18H18F5N5O2/c19-13-12(1-4-24-14(13)16(20)21)25-17(30)27-5-3-11-10(8-27)15-18(22,23)7-9(29)2-6-28(15)26-11/h1,4,9,16,29H,2-3,5-8H2,(H,24,25,30)/t9-/m0/s1 |
| InChIKey | LNAITGKKQYZOEZ-VIFPVBQESA-N |
| XLogP | 3.19 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |