ethyl 3,3-dimethoxy-2-methylprop-2-enoate

C8H14O4 — CID 155341480

IUPACethyl 3,3-dimethoxy-2-methylprop-2-enoate
SMILESCCOC(=O)C(C)=C(OC)OC
InChIInChI=1S/C8H14O4/c1-5-12-7(9)6(2)8(10-3)11-4/h5H2,1-4H3
InChIKeyBEDARHNXAVYGPV-UHFFFAOYSA-N
MW174.20 g/mol
LogP1.07
Rot. Bonds4

About ethyl 3,3-dimethoxy-2-methylprop-2-enoate

ethyl 3,3-dimethoxy-2-methylprop-2-enoate (PubChem CID 155341480) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is ethyl 3,3-dimethoxy-2-methylprop-2-enoate.

Molecular Properties

Compound Nameethyl 3,3-dimethoxy-2-methylprop-2-enoate
PubChem CID155341480
Molecular FormulaC8H14O4
Molecular Weight174.20 g/mol
Exact Mass174.09
IUPAC Nameethyl 3,3-dimethoxy-2-methylprop-2-enoate
SMILESCCOC(=O)C(C)=C(OC)OC
InChIInChI=1S/C8H14O4/c1-5-12-7(9)6(2)8(10-3)11-4/h5H2,1-4H3
InChIKeyBEDARHNXAVYGPV-UHFFFAOYSA-N
XLogP1.07
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.20
LogP ≤ 51.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethyl 3,3-dimethoxy-2-methylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,3-dimethoxy-2-methylprop-2-enoate?
The IUPAC name of ethyl 3,3-dimethoxy-2-methylprop-2-enoate (CID 155341480) is ethyl 3,3-dimethoxy-2-methylprop-2-enoate.
What is the SMILES notation for ethyl 3,3-dimethoxy-2-methylprop-2-enoate?
The canonical SMILES for ethyl 3,3-dimethoxy-2-methylprop-2-enoate is CCOC(=O)C(C)=C(OC)OC.
What is the InChIKey of ethyl 3,3-dimethoxy-2-methylprop-2-enoate?
The InChIKey is BEDARHNXAVYGPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-5-12-7(9)6(2)8(10-3)11-4/h5H2,1-4H3.
What are the key properties of ethyl 3,3-dimethoxy-2-methylprop-2-enoate?
ethyl 3,3-dimethoxy-2-methylprop-2-enoate has a molecular weight of 174.20 g/mol, XLogP of 1.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,3-dimethoxy-2-methylprop-2-enoate is sourced from PubChem (CID 155341480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).