C14H24O — CID 15534198
2,3,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclododeca[b]furan (PubChem CID 15534198) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclododeca[b]furan.
| Compound Name | 2,3,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclododeca[b]furan |
|---|---|
| PubChem CID | 15534198 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclododeca[b]furan |
| SMILES | C1CCCCCC2=C(CCCC1)CCO2 |
| InChI | InChI=1S/C14H24O/c1-2-4-6-8-10-14-13(11-12-15-14)9-7-5-3-1/h1-12H2 |
| InChIKey | IXVFFNMBUPXTLA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |