C26H12I4 — CID 155342047
3,4,9,10-tetraiodo-1-phenylperylene (PubChem CID 155342047) has the molecular formula C26H12I4 and a molecular weight of 832.00 g/mol. Its IUPAC name is 3,4,9,10-tetraiodo-1-phenylperylene.
| Compound Name | 3,4,9,10-tetraiodo-1-phenylperylene |
|---|---|
| PubChem CID | 155342047 |
| Molecular Formula | C26H12I4 |
| Molecular Weight | 832.00 g/mol |
| Exact Mass | 831.71 |
| IUPAC Name | 3,4,9,10-tetraiodo-1-phenylperylene |
| SMILES | Ic1ccc2c3ccc(I)c4c(I)cc(-c5ccccc5)c(c5ccc(I)c1c25)c43 |
| InChI | InChI=1S/C26H12I4/c27-18-9-6-14-15-7-10-20(29)26-21(30)12-17(13-4-2-1-3-5-13)23(24(15)26)16-8-11-19(28)25(18)22(14)16/h1-12H |
| InChIKey | CCZUSSNRWYVHPD-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.00 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|