About 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile
2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile (PubChem CID 15534214) has the molecular formula C7H11Cl2NO
and a molecular weight of 196.08 g/mol. Its IUPAC name is 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile |
| PubChem CID | 15534214 |
| Molecular Formula | C7H11Cl2NO |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(C)C(O)C(Cl)(Cl)C#N |
| InChI | InChI=1S/C7H11Cl2NO/c1-6(2,3)5(11)7(8,9)4-10/h5,11H,1-3H3 |
| InChIKey | BRAGPAVMUHWEOQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile?
The IUPAC name of 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile (CID 15534214) is 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile.
What is the SMILES notation for 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile?
The canonical SMILES for 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile is CC(C)(C)C(O)C(Cl)(Cl)C#N.
What is the InChIKey of 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile?
The InChIKey is BRAGPAVMUHWEOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11Cl2NO/c1-6(2,3)5(11)7(8,9)4-10/h5,11H,1-3H3.
What are the key properties of 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile?
2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile has a molecular weight of 196.08 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-3-hydroxy-4,4-dimethylpentanenitrile is sourced from PubChem (CID 15534214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).