C36H45FN2O10 — CID 155342429
(2S,3R)-3-cyclopropyl-3-[3-[4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propan-2-ylamino]methyl]benzoyl]oxyphenyl]-2-methylpropanoic acid (PubChem CID 155342429) has the molecular formula C36H45FN2O10 and a molecular weight of 684.76 g/mol. Its IUPAC name is (2S,3R)-3-cyclopropyl-3-[3-[4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propan-2-ylamino]methyl]benzoyl]oxyphenyl]-2-methylpropanoic acid.
| Compound Name | (2S,3R)-3-cyclopropyl-3-[3-[4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propan-2-ylamino]methyl]benzoyl]oxyphenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 155342429 |
| Molecular Formula | C36H45FN2O10 |
| Molecular Weight | 684.76 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | (2S,3R)-3-cyclopropyl-3-[3-[4-(5-fluoro-2-methoxy-4-pyridinyl)-3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propan-2-ylamino]methyl]benzoyl]oxyphenyl]-2-methylpropanoic acid |
| SMILES | COc1cc(-c2ccc(C(=O)Oc3cccc(C(C4CC4)[C@H](C)C(=O)O)c3)cc2CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(C)C)c(F)cn1 |
| InChI | InChI=1S/C36H45FN2O10/c1-19(2)39(17-29(41)33(43)34(44)30(42)18-40)16-24-12-23(10-11-26(24)27-14-31(48-4)38-15-28(27)37)36(47)49-25-7-5-6-22(13-25)32(21-8-9-21)20(3)35(45)46/h5-7,10-15,19-21,29-30,32-34,40-44H,8-9,16-18H2,1-4H3,(H,45,46)/t20-,29-,30+,32?,33+,34+/m0/s1 |
| InChIKey | AUEDWLVUMPJJQE-VWENJOGISA-N |
| XLogP | 2.98 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|