C25H22Cl2F2N4O3 — CID 155342702
(11R)-12-(3,4-dichlorobenzoyl)-4-[[4-(difluoromethoxy)phenyl]methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 155342702) has the molecular formula C25H22Cl2F2N4O3 and a molecular weight of 535.38 g/mol. Its IUPAC name is (11R)-12-(3,4-dichlorobenzoyl)-4-[[4-(difluoromethoxy)phenyl]methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-12-(3,4-dichlorobenzoyl)-4-[[4-(difluoromethoxy)phenyl]methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 155342702 |
| Molecular Formula | C25H22Cl2F2N4O3 |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | (11R)-12-(3,4-dichlorobenzoyl)-4-[[4-(difluoromethoxy)phenyl]methyl]-11-methyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)c1ccc(Cl)c(Cl)c1)C(=O)N(Cc1ccc(OC(F)F)cc1)CC3 |
| InChI | InChI=1S/C25H22Cl2F2N4O3/c1-14-10-21-18(13-32(14)23(34)16-4-7-19(26)20(27)11-16)22-24(35)31(8-9-33(22)30-21)12-15-2-5-17(6-3-15)36-25(28)29/h2-7,11,14,25H,8-10,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | NEGVWUNULMNZIT-CQSZACIVSA-N |
| XLogP | 5.03 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |