C14H15F3N4O3 — CID 155342717
11-methylidene-14-oxo-13-(2,2,2-trifluoroethyl)-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid (PubChem CID 155342717) has the molecular formula C14H15F3N4O3 and a molecular weight of 344.29 g/mol. Its IUPAC name is 11-methylidene-14-oxo-13-(2,2,2-trifluoroethyl)-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid.
| Compound Name | 11-methylidene-14-oxo-13-(2,2,2-trifluoroethyl)-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid |
|---|---|
| PubChem CID | 155342717 |
| Molecular Formula | C14H15F3N4O3 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 11-methylidene-14-oxo-13-(2,2,2-trifluoroethyl)-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid |
| SMILES | C=C1CN(CC(F)(F)F)C(=O)c2c3c(nn2C1)CCN(C(=O)O)C3 |
| InChI | InChI=1S/C14H15F3N4O3/c1-8-4-20(7-14(15,16)17)12(22)11-9-6-19(13(23)24)3-2-10(9)18-21(11)5-8/h1-7H2,(H,23,24) |
| InChIKey | CCKDTCZRUIGTMS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|