C12H17FN4O — CID 155342772
(5R,11R)-11-fluoro-5,13-dimethyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one (PubChem CID 155342772) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is (5R,11R)-11-fluoro-5,13-dimethyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one.
| Compound Name | (5R,11R)-11-fluoro-5,13-dimethyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
|---|---|
| PubChem CID | 155342772 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (5R,11R)-11-fluoro-5,13-dimethyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1)C(=O)N(C)C[C@@H](F)C3 |
| InChI | InChI=1S/C12H17FN4O/c1-7-3-10-9(4-14-7)11-12(18)16(2)5-8(13)6-17(11)15-10/h7-8,14H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | GWWBPUYQBCOSCF-HTQZYQBOSA-N |
| XLogP | 0.34 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |