C16H26N6O3 — CID 155343000
tert-butyl 2-hydrazinyl-4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 155343000) has the molecular formula C16H26N6O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl 2-hydrazinyl-4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | tert-butyl 2-hydrazinyl-4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 155343000 |
| Molecular Formula | C16H26N6O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | tert-butyl 2-hydrazinyl-4-morpholin-4-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(nc(NN)nc2N2CCOCC2)C1 |
| InChI | InChI=1S/C16H26N6O3/c1-16(2,3)25-15(23)22-5-4-11-12(10-22)18-14(20-17)19-13(11)21-6-8-24-9-7-21/h4-10,17H2,1-3H3,(H,18,19,20) |
| InChIKey | GVMKWWQWDUMLAK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|